EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O2 |
| Net Charge | 0 |
| Average Mass | 335.407 |
| Monoisotopic Mass | 335.16338 |
| SMILES | Cc1cccc(-c2nc(C(C)(C)C)nc2-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C20H21N3O2/c1-12-6-5-7-14(21-12)18-17(22-19(23-18)20(2,3)4)13-8-9-15-16(10-13)25-11-24-15/h5-10H,11H2,1-4H3,(H,22,23) |
| InChIKey | WGZOTBUYUFBEPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | TGFbeta receptor antagonist An antagonist that binds to and deactivates TGFβ receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 505124 (CHEBI:100922) has role TGFβ receptor antagonist (CHEBI:91202) |
| SB 505124 (CHEBI:100922) is a benzodioxole (CHEBI:38733) |
| SB 505124 (CHEBI:100922) is a imidazoles (CHEBI:24780) |
| SB 505124 (CHEBI:100922) is a methylpyridines (CHEBI:25340) |
| IUPAC Name |
|---|
| 2-[4-(2H-1,3-benzodioxol-5-yl)-2-tert-butyl-1H-imidazol-5-yl]-6-methylpyridine |
| Synonyms | Source |
|---|---|
| 2-[4-(1,3-benzodioxol-5-yl)-2-(1,1-dimethylethyl)-1H-imidazol-5-yl]-6-methyl-pyridin | ChEBI |
| SB-505124 | ChEBI |
| SB505124 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11751238 | Reaxys |
| Citations |
|---|