EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O5 |
| Net Charge | 0 |
| Average Mass | 152.146 |
| Monoisotopic Mass | 152.06847 |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h212h]/1/ |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
| InChIKey | HEBKCHPVOIAQTA-SCDXWVJYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). sweetening agent Substance that sweeten food, beverages, medications, etc. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xylitol (CHEBI:17151) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| xylitol (CHEBI:17151) has role algal metabolite (CHEBI:84735) |
| xylitol (CHEBI:17151) has role allergen (CHEBI:50904) |
| xylitol (CHEBI:17151) has role hapten (CHEBI:59174) |
| xylitol (CHEBI:17151) has role human metabolite (CHEBI:77746) |
| xylitol (CHEBI:17151) has role mouse metabolite (CHEBI:75771) |
| xylitol (CHEBI:17151) has role sweetening agent (CHEBI:50505) |
| xylitol (CHEBI:17151) is a pentitol (CHEBI:25899) |
| Incoming Relation(s) |
| xylitol 5-phosphate (CHEBI:16772) has functional parent xylitol (CHEBI:17151) |
| xylitol 5-phosphate(2−) (CHEBI:370252) has functional parent xylitol (CHEBI:17151) |
| IUPAC Names |
|---|
| meso-xylitol |
| (2R,3r,4S)-pentane-1,2,3,4,5-pentol |
| Synonyms | Source |
|---|---|
| Xylitol | KEGG COMPOUND |
| xylite | NIST Chemistry WebBook |
| Xylit | ChEBI |
| D-XYLITOL | PDBeChem |
| (2R,3R,4S)-Pentane-1,2,3,4,5-pentaol | ChEMBL |
| L-xylitol | ChEBI |
| UniProt Name | Source |
|---|---|
| xylitol | UniProt |
| Citations |
|---|