EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N3O5 |
| Net Charge | 0 |
| Average Mass | 339.392 |
| Monoisotopic Mass | 339.17942 |
| SMILES | O=C(NCCNCC(O)COc1ccc(O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) |
| InChIKey | DXPOSRCHIDYWHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xamoterol (CHEBI:10055) has role cardiovascular drug (CHEBI:35554) |
| Xamoterol (CHEBI:10055) is a morpholines (CHEBI:38785) |
| Synonyms | Source |
|---|---|
| ICI-118,587 | ChEMBL |
| ICI-118587 | ChEMBL |
| Xamoterol | KEGG COMPOUND |
| xamoterol fumarate | DrugCentral |
| xamoterol hemifumarate | DrugCentral |
| Citations |
|---|