EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H26N2O6 |
| Net Charge | 0 |
| Average Mass | 486.524 |
| Monoisotopic Mass | 486.17909 |
| SMILES | O=C(O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(C=Cc4ccccc4)c3=O)[C@@H]2N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H26N2O6/c31-15-21-20-14-29-22(10-9-19(27(29)32)8-6-17-4-2-1-3-5-17)25(20)30(26(21)28(33)34)13-18-7-11-23-24(12-18)36-16-35-23/h1-12,20-21,25-26,31H,13-16H2,(H,33,34)/t20-,21-,25+,26-/m0/s1 |
| InChIKey | JUBZNFCZFZOAAP-MSNAGZIKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-11903 (CHEBI:100529) is a L-α-amino acid (CHEBI:15705) |
| Manual Xrefs | Databases |
|---|---|
| LSM-11903 | LINCS |