EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O6 |
| Net Charge | 0 |
| Average Mass | 384.428 |
| Monoisotopic Mass | 384.15729 |
| SMILES | COc1c2c(cc3c1-c1c(cc4c(c1OC)OCO4)C[C@H](C)[C@H](C)C3)OCO2 |
| InChI | InChI=1S/C22H24O6/c1-11-5-13-7-15-19(27-9-25-15)21(23-3)17(13)18-14(6-12(11)2)8-16-20(22(18)24-4)28-10-26-16/h7-8,11-12H,5-6,9-10H2,1-4H3/t11-,12+ |
| InChIKey | HTBWBWWADZJXID-TXEJJXNPSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Wuweizisu C (CHEBI:10044) is a tannin (CHEBI:26848) |
| Synonyms | Source |
|---|---|
| Schizandrin C | KEGG COMPOUND |
| Wuweizisu C | KEGG COMPOUND |
| Wuweizisu C | KEGG COMPOUND |