EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CC(C)=CCc1c(O)cc2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| InChIKey | KIMDVVKVNNSHGZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) | |
| Ficus mucuso (ncbitaxon:309328) | fruit (BTO:0000486) | PubMed (21619045) | Methanolic extract of air-dried and powdered figs(fruits) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wighteone (CHEBI:10038) has functional parent isoflavone (CHEBI:18220) |
| wighteone (CHEBI:10038) has role antifungal agent (CHEBI:35718) |
| wighteone (CHEBI:10038) has role plant metabolite (CHEBI:76924) |
| wighteone (CHEBI:10038) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7,4'-trihydroxy-6-prenylisoflavone | LIPID MAPS |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| erythrinin B | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002586 | KNApSAcK |
| C10542 | KEGG COMPOUND |
| LMPK12050188 | LIPID MAPS |
| Wighteone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1265128 | Reaxys |
| CAS:51225-30-0 | ChemIDplus |
| CAS:51225-30-0 | KEGG COMPOUND |
| Citations |
|---|