EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O7 |
| Net Charge | 0 |
| Average Mass | 339.304 |
| Monoisotopic Mass | 339.10665 |
| SMILES | NC(=O)CC[C@H](/N=C\C=C1\C=C(C(=O)O)N[C@H](C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C14H17N3O7/c15-11(18)2-1-8(12(19)20)16-4-3-7-5-9(13(21)22)17-10(6-7)14(23)24/h3-5,8,10,17H,1-2,6H2,(H2,15,18)(H,19,20)(H,21,22)(H,23,24)/b7-3-,16-4-/t8-,10-/m0/s1 |
| InChIKey | PDBJJFJKNSKTSW-IRFVBRLPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vulgaxanthin-I (CHEBI:10025) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Vulgaxanthin-I | KEGG COMPOUND |