EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:100246 - norfloxacin
| Formula | C16H18FN3O3 |
| Net Charge | 0 |
| Average Mass | 319.336 |
| Monoisotopic Mass | 319.13322 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23) |
| InChIKey | OGJPXUAPXNRGGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norfloxacin (CHEBI:100246) has role antibacterial agent (CHEBI:33282) |
| norfloxacin (CHEBI:100246) has role antibacterial drug (CHEBI:36047) |
| norfloxacin (CHEBI:100246) has role DNA synthesis inhibitor (CHEBI:59517) |
| norfloxacin (CHEBI:100246) has role environmental contaminant (CHEBI:78298) |
| norfloxacin (CHEBI:100246) has role hepatoprotective agent (CHEBI:62868) |
| norfloxacin (CHEBI:100246) has role ophthalmology drug (CHEBI:66981) |
| norfloxacin (CHEBI:100246) has role xenobiotic (CHEBI:35703) |
| norfloxacin (CHEBI:100246) is a N-arylpiperazine (CHEBI:46848) |
| norfloxacin (CHEBI:100246) is a fluoroquinolone antibiotic (CHEBI:87211) |
| norfloxacin (CHEBI:100246) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| norfloxacin (CHEBI:100246) is a quinolone (CHEBI:23765) |
| norfloxacin (CHEBI:100246) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| norfloxacin | KEGG DRUG |
| norfloxacine | ChemIDplus |
| norfloxacino | ChemIDplus |
| norfloxacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsäure | ChemIDplus |
| 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid | ChemIDplus |
| MK-366 | ChEMBL |
| NFLX | KEGG DRUG |
| NSC-757250 | ChEMBL |
| Brand Names | Source |
|---|---|
| Baccidal | ChEMBL |
| Chibroxin | ChEMBL |
| Noroxin | ChEMBL |
| Quinabic | ChEMBL |
| Utinor | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1576626 | Gmelin |
| Reaxys:567897 | Reaxys |
| CAS:70458-96-7 | KEGG COMPOUND |
| CAS:70458-96-7 | ChemIDplus |
| Citations |
|---|