EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:100246 - norfloxacin
| Formula | C16H18FN3O3 |
| Net Charge | 0 |
| Average Mass | 319.336 |
| Monoisotopic Mass | 319.13322 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 |
| InChI | InChI=1S/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23) |
| InChIKey | OGJPXUAPXNRGGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norfloxacin (CHEBI:100246) has role antibacterial drug (CHEBI:36047) |
| norfloxacin (CHEBI:100246) has role DNA synthesis inhibitor (CHEBI:59517) |
| norfloxacin (CHEBI:100246) has role environmental contaminant (CHEBI:78298) |
| norfloxacin (CHEBI:100246) has role xenobiotic (CHEBI:35703) |
| norfloxacin (CHEBI:100246) is a N-arylpiperazine (CHEBI:46848) |
| norfloxacin (CHEBI:100246) is a fluoroquinolone antibiotic (CHEBI:87211) |
| norfloxacin (CHEBI:100246) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| norfloxacin (CHEBI:100246) is a quinolone (CHEBI:23765) |
| norfloxacin (CHEBI:100246) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| norfloxacin | KEGG DRUG |
| norfloxacinum | ChemIDplus |
| norfloxacino | ChemIDplus |
| norfloxacine | ChemIDplus |
| Synonyms | Source |
|---|---|
| NFLX | KEGG DRUG |
| 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsäure | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1576626 | Gmelin |
| Reaxys:567897 | Reaxys |
| CAS:70458-96-7 | KEGG COMPOUND |
| CAS:70458-96-7 | ChemIDplus |
| Citations |
|---|