EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14F3N5O |
| Net Charge | 0 |
| Average Mass | 349.316 |
| Monoisotopic Mass | 349.11504 |
| SMILES | C[C@@H](c1ncncc1F)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14F3N5O/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18/h2-5,7-10,25H,6H2,1H3/t10-,16+/m0/s1 |
| InChIKey | BCEHBSKCWLPMDN-MGPLVRAMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| voriconazole (CHEBI:10023) has role P450 inhibitor (CHEBI:50183) |
| voriconazole (CHEBI:10023) is a conazole antifungal drug (CHEBI:87071) |
| voriconazole (CHEBI:10023) is a difluorobenzene (CHEBI:38582) |
| voriconazole (CHEBI:10023) is a pyrimidines (CHEBI:39447) |
| voriconazole (CHEBI:10023) is a tertiary alcohol (CHEBI:26878) |
| voriconazole (CHEBI:10023) is a triazole antifungal drug (CHEBI:87101) |
| IUPAC Name |
|---|
| (2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
| INNs | Source |
|---|---|
| voriconazole | ChemIDplus |
| voriconazolum | WHO MedNet |
| voriconazol | WHO MedNet |
| voriconazole | WHO MedNet |
| Synonyms | Source |
|---|---|
| VCZ | DrugBank |
| (αR,βS)-α-(2,4-difluorophenyl)-5-fluoro-β-methyl-α(1H-1,2,4-triazol-1-ylmethyl)-4-pyrimidineethanol | ChemIDplus |
| (R-(R*,S*))-alpha-(2,4-difluorophenyl)-5-fluoro-beta-methyl-alpha-(1H-1,2,4-triazol-1-ylmethyl)-4-pyrimidineethanol | ChEBI |
| Brand Name | Source |
|---|---|
| Vfend | ChEBI |
| UniProt Name | Source |
|---|---|
| voriconazole | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7694998 | Beilstein |
| CAS:137234-62-9 | KEGG COMPOUND |
| CAS:137234-62-9 | KEGG DRUG |
| CAS:137234-62-9 | DrugBank |
| CAS:137234-62-9 | ChemIDplus |
| Citations |
|---|