EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO7 |
| Net Charge | 0 |
| Average Mass | 287.268 |
| Monoisotopic Mass | 287.10050 |
| SMILES | N#C[C@]1(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C[C@H](O)C1 |
| InChI | InChI=1S/C12H17NO7/c13-5-12(2-1-6(15)3-12)20-11-10(18)9(17)8(16)7(4-14)19-11/h1-2,6-11,14-18H,3-4H2/t6-,7+,8+,9-,10+,11-,12-/m0/s1 |
| InChIKey | JRCWYCAEAZEYNW-WTMYBKBASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| volkenin (CHEBI:10018) is a aliphatic nitrile (CHEBI:80291) |
| volkenin (CHEBI:10018) is a cyanogenic glycoside (CHEBI:23436) |
| volkenin (CHEBI:10018) is a monosaccharide derivative (CHEBI:63367) |
| volkenin (CHEBI:10018) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (1R,4R)-1-(β-D-glucopyranosyloxy)-4-hydroxycyclopent-2-ene-1-carbonitrile |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4703787 | Reaxys |
| CAS:66575-40-4 | KEGG COMPOUND |
| CAS:66575-40-4 | ChemIDplus |
| Citations |
|---|