EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16O7 |
| Net Charge | 0 |
| Average Mass | 212.198 |
| Monoisotopic Mass | 212.08960 |
| SMILES | OC[C@@H](O)[C@@H](O)C(O)[C@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h11222h]/1/ |
| InChI | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | OXQKEKGBFMQTML-KVTDHHQDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| volemitol (CHEBI:10017) has role metabolite (CHEBI:25212) |
| volemitol (CHEBI:10017) is a heptitol (CHEBI:46658) |
| IUPAC Name |
|---|
| (2R,3R,5R,6R)-heptane-1,2,3,4,5,6,7-heptol |
| Synonym | Source |
|---|---|
| D-glycero-D-manno-Heptitol | KEGG COMPOUND |
| Citations |
|---|