EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H50N4O6 |
| Net Charge | 0 |
| Average Mass | 718.895 |
| Monoisotopic Mass | 718.37304 |
| SMILES | [H][C@@]12C[C@]3(CN4CC[C@]56C(=C(C(=O)OC)C[C@@]7(CCO[C@@]37[H])[C@]45[H])Nc3ccccc36)CN3c4c(OC)cccc4[C@@]4(CCN5CC[C@]6([H])OCC[C@]6(C1)[C@]54[H])[C@@]32O |
| InChI | InChI=1S/C43H50N4O6/c1-50-30-9-5-7-28-32(30)47-24-38(20-25-21-39-13-18-52-31(39)10-15-45-17-12-42(28,36(39)45)43(25,47)49)23-46-16-11-41-27-6-3-4-8-29(27)44-33(41)26(34(48)51-2)22-40(35(41)46)14-19-53-37(38)40/h3-9,25,31,35-37,44,49H,10-24H2,1-2H3/t25-,31+,35+,36+,37+,38+,39-,40+,41+,42-,43-/m1/s1 |
| InChIKey | IIMPGJMHQMBXKL-OPDPKHDKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vobtusine (CHEBI:10016) is a alkaloid ester (CHEBI:38481) |
| vobtusine (CHEBI:10016) is a hemiaminal (CHEBI:73080) |
| vobtusine (CHEBI:10016) is a indole alkaloid fundamental parent (CHEBI:38482) |
| vobtusine (CHEBI:10016) is a methyl ester (CHEBI:25248) |
| vobtusine (CHEBI:10016) is a spiro compound (CHEBI:33599) |
| vobtusine (CHEBI:10016) is a vinca alkaloid (CHEBI:27288) |
| IUPAC Name |
|---|
| vobtusine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4641215 | Beilstein |
| Beilstein:77486 | Beilstein |
| CAS:19772-79-3 | KEGG COMPOUND |
| CAS:19772-79-3 | ChemIDplus |