EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O3 |
| Net Charge | 0 |
| Average Mass | 232.239 |
| Monoisotopic Mass | 232.08479 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) |
| InChIKey | MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nalidixic acid (CHEBI:100147) has role antibacterial drug (CHEBI:36047) |
| nalidixic acid (CHEBI:100147) has role antimicrobial agent (CHEBI:33281) |
| nalidixic acid (CHEBI:100147) has role DNA synthesis inhibitor (CHEBI:59517) |
| nalidixic acid (CHEBI:100147) is a 1,8-naphthyridine derivative (CHEBI:73537) |
| nalidixic acid (CHEBI:100147) is a monocarboxylic acid (CHEBI:25384) |
| nalidixic acid (CHEBI:100147) is a quinolone antibiotic (CHEBI:86324) |
| nalidixic acid (CHEBI:100147) is conjugate acid of nalidixic acid anion (CHEBI:62070) |
| Incoming Relation(s) |
| nalidixic acid anion (CHEBI:62070) is conjugate base of nalidixic acid (CHEBI:100147) |
| IUPAC Name |
|---|
| 1-ethyl-7-methyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| INNs | Source |
|---|---|
| acide nalidixique | ChemIDplus |
| acido nalidixico | ChemIDplus |
| acidum nalidixicum | ChemIDplus |
| nalidixic acid | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,4-dihydro-1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid | ChemIDplus |
| 1-Aethyl-7-methyl-1,8-naphthyridin-4-on-3-karbonsaeure | ChemIDplus |
| 1-ethyl-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid | ChemIDplus |
| 1-ethyl-7-methyl-1,4-dihydro-1,8-naphthyridin-4-one-3-carboxylic acid | ChemIDplus |
| 1-Ethyl-7-methyl-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid | ChEMBL |
| 3-carboxy-1-ethyl-7-methyl-1,8-naphthyridin-4-one | ChemIDplus |
| Citations |
|---|