EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:10003 - ribostamycin sulfate
| Formula | (H2O4S)n.C17H34N4O10 |
| Net Charge | 0 |
| Average Mass | 552.556 |
| Monoisotopic Mass | 552.19487 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](N)[C@@H](O)[C@@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C17H34N4O10.H2O4S/c18-2-6-10(24)12(26)8(21)16(28-6)30-14-5(20)1-4(19)9(23)15(14)31-17-13(27)11(25)7(3-22)29-17;1-5(2,3)4/h4-17,22-27H,1-3,18-21H2;(H2,1,2,3,4)/t4-,5+,6-,7-,8-,9+,10-,11-,12-,13-,14-,15-,16-,17+;/m1./s1 |
| InChIKey | RTCDDYYZMGGHOE-YMSVYGIHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ribostamycin sulfate (CHEBI:10003) has part ribostamycin(4+) (CHEBI:65028) |
| ribostamycin sulfate (CHEBI:10003) has role antibacterial agent (CHEBI:33282) |
| ribostamycin sulfate (CHEBI:10003) has role antibacterial drug (CHEBI:36047) |
| ribostamycin sulfate (CHEBI:10003) has role antimicrobial agent (CHEBI:33281) |
| ribostamycin sulfate (CHEBI:10003) is a aminoglycoside (CHEBI:47779) |
| ribostamycin sulfate (CHEBI:10003) is a aminoglycoside sulfate salt (CHEBI:38012) |
| Synonyms | Source |
|---|---|
| Landamycine | ChemIDplus |
| Ribomycine | ChemIDplus |
| ribostamycin A sulfate | ChEBI |
| SF 733 antibioic sulfate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Vistamycin | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8820400 | Reaxys |
| CAS:53797-35-6 | KEGG DRUG |
| CAS:53797-35-6 | ChemIDplus |