EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O7 |
| Net Charge | 0 |
| Average Mass | 388.416 |
| Monoisotopic Mass | 388.15220 |
| SMILES | CC[C@@H](C)C(=O)O[C@@H]1[C@H](OC(C)=O)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| InChI | InChI=1S/C21H24O7/c1-6-11(2)20(24)27-19-18(25-12(3)22)16-14(28-21(19,4)5)9-7-13-8-10-15(23)26-17(13)16/h7-11,18-19H,6H2,1-5H3/t11-,18-,19-/m1/s1 |
| InChIKey | GVBNSPFBYXGREE-CXWAGAITSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Visnadin (CHEBI:10001) has role cardiovascular drug (CHEBI:35554) |
| Visnadin (CHEBI:10001) is a coumarins (CHEBI:23403) |
| INN | Source |
|---|---|
| visnadina | WHO MedNet |
| Synonyms | Source |
|---|---|
| visnacorin | DrugCentral |
| Visnadin | KEGG COMPOUND |
| visnadine | ChEMBL |
| Visnadine | KEGG COMPOUND |
| visnamine | DrugCentral |