EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H42N4O6 |
| Net Charge | 0 |
| Average Mass | 602.732 |
| Monoisotopic Mass | 602.31044 |
| SMILES | [H][C@]12CCCCN1C(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCCC(=O)[C@@H]1CO1)NC2=O |
| InChI | InChI=1S/C34H42N4O6/c39-29(30-22-44-30)18-9-3-8-16-25-31(40)36-26(20-23-12-4-1-5-13-23)32(41)37-27(21-24-14-6-2-7-15-24)34(43)38-19-11-10-17-28(38)33(42)35-25/h1-2,4-7,12-15,25-28,30H,3,8-11,16-22H2,(H,35,42)(H,36,40)(H,37,41)/t25-,26-,27-,28+,30-/m0/s1 |
| InChIKey | GXVXXETYXSPSOA-UFEOFEBPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Helicoma ambiens (ncbitaxon:314151) | - | PubMed (2276972) | Strain: RF-1023 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trapoxin A (CHEBI:84057) has role antineoplastic agent (CHEBI:35610) |
| trapoxin A (CHEBI:84057) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| trapoxin A (CHEBI:84057) has role fungal metabolite (CHEBI:76946) |
| trapoxin A (CHEBI:84057) is a epoxide (CHEBI:32955) |
| trapoxin A (CHEBI:84057) is a homodetic cyclic peptide (CHEBI:24613) |
| trapoxin A (CHEBI:84057) is a ketone (CHEBI:17087) |
| IUPAC Name |
|---|
| (3S,6S,9S,15aR)-6,9-dibenzyl-3-{6-[(2S)-oxiran-2-yl]-6-oxohexyl}octahydro-2H-pyrido[1,2-a][1,4,7,10]tetraazacyclododecine-1,4,7,10(3H,12H)-tetrone |
| Synonyms | Source |
|---|---|
| RF 1023A | KNApSAcK |
| Cyclo((S)-phenylalanyl-(S)-phenylalanyl-(R)-pipecolinyl-(2S,9S)-2-amino-8-oxo-9,10-epoxydecanoyl) | ChemIDplus |
| Cyclo((S)-gamma-oxo-L-alpha-aminooxiraneoctanoyl-L-phenylalanyl-L-phenylalanyl-D-2-piperidinecarbonyl) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00017061 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8817133 | Reaxys |
| CAS:133155-89-2 | ChemIDplus |
| Citations |
|---|