EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35890 - trimethylphosphine
| Formula | C3H9P |
| Net Charge | 0 |
| Average Mass | 76.079 |
| Monoisotopic Mass | 76.04419 |
| SMILES | CP(C)C |
| InChI | InChI=1S/C3H9P/c1-4(2)3/h1-3H3 |
| InChIKey | YWWDBCBWQNCYNR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethylphosphine (CHEBI:35890) is a tertiary phosphine (CHEBI:35886) |
| IUPAC Names |
|---|
| trimethylphosphane |
| trimethylphosphorus |
| Synonyms | Source |
|---|---|
| trimethylphosphine | NIST Chemistry WebBook |
| trimethyl phosphine | ChemIDplus |
| Me3P | ChEBI |
| (CH3)3P | NIST Chemistry WebBook |
| PMe3 | ChEBI |