EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC(=O)[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H28O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h11-14,17,20H,3-10H2,1-2H3/t11-,12+,13-,14-,17+,18-,19-/m0/s1 |
| InChIKey | IUNYGQONJQTULL-UFTZPVOZSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-Ketoandrosterone (CHEBI:34134) has role androgen (CHEBI:50113) |
| 11-Ketoandrosterone (CHEBI:34134) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 11-Ketoandrosterone | KEGG COMPOUND |
| 3alpha-Hydroxy-5alpha-androstane-11,17-dione | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 3α-hydroxy-5α-androstan-11,17-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14671 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1231-82-9 | KEGG COMPOUND |