EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O2 |
| Net Charge | 0 |
| Average Mass | 280.452 |
| Monoisotopic Mass | 280.24023 |
| SMILES | C#CCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h1H,3-17H2,(H,19,20) |
| InChIKey | DZIILFGADWDKMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. EC 1.14.14.94 (leukotriene-B4 20-monooxygenase) inhibitor Any EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor that interferes with the action of leukotriene-B4 20-monooxygenase (EC 1.14.14.94). EC 1.14.15.3 (alkane 1-monooxygenase) inhibitor Any EC 1.14.15.* (oxidoreductase acting on paired donors, with reduced Fe-S protein as one donor, incorporating 1 O atom) inhibitor that interferes with the action of alkane 1-monooxygenase (EC 1.14.15.3). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octadec-17-ynoic acid (CHEBI:142447) has role EC 1.14.14.94 (leukotriene-B4 20-monooxygenase) inhibitor (CHEBI:142480) |
| octadec-17-ynoic acid (CHEBI:142447) has role EC 1.14.15.3 (alkane 1-monooxygenase) inhibitor (CHEBI:142481) |
| octadec-17-ynoic acid (CHEBI:142447) has role P450 inhibitor (CHEBI:50183) |
| octadec-17-ynoic acid (CHEBI:142447) is a acetylenic fatty acid (CHEBI:25380) |
| octadec-17-ynoic acid (CHEBI:142447) is a long-chain fatty acid (CHEBI:15904) |
| octadec-17-ynoic acid (CHEBI:142447) is a monounsaturated fatty acid (CHEBI:25413) |
| octadec-17-ynoic acid (CHEBI:142447) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| octadec-17-ynoic acid |
| Synonyms | Source |
|---|---|
| 17-octadecynoic acid | ChEBI |
| 17-ODYA | ChemIDplus |
| 17-octadecyn-1-oic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030575 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2048022 | Reaxys |
| CAS:34450-18-5 | ChemIDplus |
| CAS:34450-18-5 | NIST Chemistry WebBook |
| Citations |
|---|