EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N7O17P3S |
| Net Charge | -4 |
| Average Mass | 805.546 |
| Monoisotopic Mass | 805.09667 |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C23H38N7O17P3S/c1-12(31)51-7-6-25-14(32)4-5-26-21(35)18(34)23(2,3)9-44-50(41,42)47-49(39,40)43-8-13-17(46-48(36,37)38)16(33)22(45-13)30-11-29-15-19(24)27-10-28-20(15)30/h10-11,13,16-18,22,33-34H,4-9H2,1-3H3,(H,25,32)(H,26,35)(H,39,40)(H,41,42)(H2,24,27,28)(H2,36,37,38)/p-4/t13-,16-,17-,18+,22-/m1/s1 |
| InChIKey | ZSLZBFCDCINBPY-ZSJPKINUSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetyl-CoA(4−) (CHEBI:57288) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| acetyl-CoA(4−) (CHEBI:57288) has role human metabolite (CHEBI:77746) |
| acetyl-CoA(4−) (CHEBI:57288) is a acyl-CoA(4−) (CHEBI:58342) |
| acetyl-CoA(4−) (CHEBI:57288) is conjugate base of acetyl-CoA (CHEBI:15351) |
| Incoming Relation(s) |
| acetyl-CoA (CHEBI:15351) is conjugate acid of acetyl-CoA(4−) (CHEBI:57288) |
| IUPAC Name |
|---|
| 3'-phosphonatoadenosine 5'-(3-{(3R)-4-[(3-{[2-(acetylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl} diphosphate) |
| Synonyms | Source |
|---|---|
| AcCoA(4−) | ChEBI |
| acetyl-CoA tetraanion | ChEBI |
| acetyl-coenzyme A(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| acetyl-CoA | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8468140 | Beilstein |