EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO5 |
| Net Charge | 0 |
| Average Mass | 331.368 |
| Monoisotopic Mass | 331.14197 |
| SMILES | [H][C@]12CN(C)[C@@]3([H])C[C@H](OC)C=C[C@@]13c1cc3c(cc1[C@H](O)O2)OCO3 |
| InChI | InChI=1S/C18H21NO5/c1-19-8-16-18(4-3-10(21-2)5-15(18)19)12-7-14-13(22-9-23-14)6-11(12)17(20)24-16/h3-4,6-7,10,15-17,20H,5,8-9H2,1-2H3/t10-,15+,16+,17-,18+/m1/s1 |
| InChIKey | KLJOYDMUWKSYBP-YNBLHMCPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pretazettine (CHEBI:8402) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Pretazettine | KEGG COMPOUND |