EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5N5O3 |
| Net Charge | 0 |
| Average Mass | 207.149 |
| Monoisotopic Mass | 207.03924 |
| SMILES | Nc1nc(=O)c2nc(C(=O)O)cnc2n1 |
| InChI | InChI=1S/C7H5N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h1H,(H,14,15)(H3,8,9,11,12,13) |
| InChIKey | QABAUCFGPWONOG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (24023812) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-4-hydroxy-6-pteridinecarboxylic acid (CHEBI:88937) has functional parent α-amino acid (CHEBI:33704) |
| 2-Amino-4-hydroxy-6-pteridinecarboxylic acid (CHEBI:88937) is a organonitrogen compound (CHEBI:35352) |
| 2-Amino-4-hydroxy-6-pteridinecarboxylic acid (CHEBI:88937) is a organooxygen compound (CHEBI:36963) |
| 2-Amino-4-hydroxy-6-pteridinecarboxylic acid (CHEBI:88937) is conjugate acid of 2-amino-4-oxo-6-pteridinecarboxylate(1−) (CHEBI:232624) |
| Incoming Relation(s) |
| 2-amino-4-oxo-6-pteridinecarboxylate(1−) (CHEBI:232624) is conjugate base of 2-Amino-4-hydroxy-6-pteridinecarboxylic acid (CHEBI:88937) |
| Synonyms | Source |
|---|---|
| 2-Amino-1,4-dihydro-4-oxo-6-Pteridinecarboxylic acid | HMDB |
| Pterine-6-carboxylic acid | HMDB |
| 2-Amino-4-hydroxypteridine-6-carboxylicacid | HMDB |
| 2-Amino-4-hydroxypteridine-6-carboxylic acid | HMDB |
| Pterin-6-carboxylic acid | HMDB |
| 2-Amino-1,4-dihydro-4-oxopteridine-6-carboxylic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033136 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:948-60-7 | KEGG COMPOUND |
| Citations |
|---|