EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N4O2 |
| Net Charge | 0 |
| Average Mass | 178.151 |
| Monoisotopic Mass | 178.04908 |
| SMILES | Nc1n[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C7H6N4O2/c8-7-9-11(13)6-4-2-1-3-5(6)10(7)12/h1-4H,(H2,8,9) |
| InChIKey | ORYDPOVDJJZGHQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tirapazamine (CHEBI:78887) has functional parent 1,2,4-benzotriazine (CHEBI:38011) |
| tirapazamine (CHEBI:78887) has role antibacterial agent (CHEBI:33282) |
| tirapazamine (CHEBI:78887) has role antineoplastic agent (CHEBI:35610) |
| tirapazamine (CHEBI:78887) has role apoptosis inducer (CHEBI:68495) |
| tirapazamine (CHEBI:78887) is a N-oxide (CHEBI:35580) |
| tirapazamine (CHEBI:78887) is a aromatic amine (CHEBI:33860) |
| tirapazamine (CHEBI:78887) is a benzotriazines (CHEBI:51361) |
| IUPAC Name |
|---|
| 1,2,4-benzotriazin-3-amine 1,4-dioxide |
| INN | Source |
|---|---|
| tirapazamine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3-Amino-1,2,4-benzotriazine 1,4-dioxide | ChemIDplus |
| SR 4233 | ChemIDplus |
| SR-4233 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06167 | KEGG DRUG |
| Tirapazamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:179322 | Reaxys |
| CAS:27314-97-2 | ChemIDplus |
| CAS:27314-97-2 | KEGG DRUG |
| Citations |
|---|