EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2 |
| Net Charge | 0 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08988 |
| SMILES | [NH3+][C@H](Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | QIVBCDIJIAJPQS-SECBINFHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tryptophan zwitterion (CHEBI:57719) is a tryptophan zwitterion (CHEBI:64554) |
| D-tryptophan zwitterion (CHEBI:57719) is tautomer of D-tryptophan (CHEBI:16296) |
| Incoming Relation(s) |
| D-tryptophan (CHEBI:16296) is tautomer of D-tryptophan zwitterion (CHEBI:57719) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-(1H-indol-3-yl)propanoate |
| Synonyms | Source |
|---|---|
| (2R)-2-ammonio-3-(1H-indol-3-yl)propanoate | ChEBI |
| tryptophan | ChEBI |
| UniProt Name | Source |
|---|---|
| D-tryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D-TRYPTOPHAN | MetaCyc |