EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O7 |
| Net Charge | 0 |
| Average Mass | 206.150 |
| Monoisotopic Mass | 206.04265 |
| SMILES | C[C@H](C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H10O7/c1-3(5(10)11)7(14,6(12)13)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t3-,7+/m1/s1 |
| InChIKey | YNOXCRMFGMSKIJ-NFNCENRGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S)-2-methylcitric acid (CHEBI:50948) is a 2-methylcitric acid (CHEBI:30835) |
| (2S,3S)-2-methylcitric acid (CHEBI:50948) is conjugate acid of (2S,3S)-2-methylcitrate(3−) (CHEBI:58853) |
| Incoming Relation(s) |
| (2S,3S)-2-methylcitrate(3−) (CHEBI:58853) is conjugate base of (2S,3S)-2-methylcitric acid (CHEBI:50948) |
| IUPAC Names |
|---|
| (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylic acid |
| 3-C-carboxy-2,4-dideoxy-4-methyl-D-erythro-pentaric acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2332363 | Beilstein |