EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O3 |
| Net Charge | 0 |
| Average Mass | 224.300 |
| Monoisotopic Mass | 224.14124 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/[C@@H](C)O |
| InChI | InChI=1S/C13H20O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,10,14,16H,8H2,1-4H3/b6-5+/t10-,13-/m1/s1 |
| InChIKey | KPQMCAKZRXOZLB-KOIHBYQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brucea javanica (ncbitaxon:210348) | seed (BTO:0001226) | DOI (10.1016/0031-9422(96)00258-0) | |
| Perrottetia multiflora (IPNI:282530-2) | aerial part (BTO:0001658) | DOI (10.1021/np50105a013) | |
| Solanum lyratum (ncbitaxon:230192) | whole plant (BTO:0001461) | PubMed (19336938) | |
| Typha latifolia (ncbitaxon:4733) | - | DOI (10.1021/np50070a031) |
| Roles Classification |
|---|
| Biological Roles: | phytotoxin Any toxin produced by a plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S,9R)-vomifoliol (CHEBI:49164) has role metabolite (CHEBI:25212) |
| (6S,9R)-vomifoliol (CHEBI:49164) has role phytotoxin (CHEBI:38231) |
| (6S,9R)-vomifoliol (CHEBI:49164) is a (6S)-vomifoliol (CHEBI:49156) |
| (6S,9R)-vomifoliol (CHEBI:49164) is enantiomer of (6R,9S)-vomifoliol (CHEBI:49160) |
| Incoming Relation(s) |
| (6R,9S)-vomifoliol (CHEBI:49160) is enantiomer of (6S,9R)-vomifoliol (CHEBI:49164) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-4-[(1E,3R)-3-hydroxybut-1-en-1-yl]-3,5,5-trimethylcyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (4S)-4-hydroxy-4-[(1E,3R)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohex-2-en-1-one | IUBMB |
| (6S,9R)-6-hydroxy-3-oxo-α-ionol | ChEBI |
| (6S,9R)-6-Hydroxy-3-oxo-alpha-ionol | KEGG COMPOUND |
| Blumenol A | NIST Chemistry WebBook |
| Vomifoliol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (6S,9R)-vomifoliol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| --6-HYDROXY-3-OXO-ALPHA-IONOL | MetaCyc |
| C00029834 | KNApSAcK |
| C01760 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1877674 | Beilstein |
| Reaxys:1877674 | Reaxys |
| CAS:23526-45-6 | KEGG COMPOUND |
| Citations |
|---|