EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H49N11O9S2 |
| Net Charge | 0 |
| Average Mass | 831.979 |
| Monoisotopic Mass | 831.31561 |
| SMILES | [H][C@@]1(Cc2cnc3ccccc23)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCCNC(=N)N)NC(=O)CCSSC[C@@H](C(N)=O)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C35H49N11O9S2/c36-30(51)25-18-57-56-13-10-27(47)42-22(8-3-4-11-39-35(37)38)31(52)41-17-28(48)43-23(15-29(49)50)32(53)44-24(14-19-16-40-21-7-2-1-6-20(19)21)34(55)46-12-5-9-26(46)33(54)45-25/h1-2,6-7,16,22-26,40H,3-5,8-15,17-18H2,(H2,36,51)(H,41,52)(H,42,47)(H,43,48)(H,44,53)(H,45,54)(H,49,50)(H4,37,38,39)/t22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | CZKPOZZJODAYPZ-LROMGURASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eptifibatide (CHEBI:291902) has role anticoagulant (CHEBI:50249) |
| eptifibatide (CHEBI:291902) has role platelet aggregation inhibitor (CHEBI:50427) |
| eptifibatide (CHEBI:291902) is a homodetic cyclic peptide (CHEBI:24613) |
| eptifibatide (CHEBI:291902) is a macrocycle (CHEBI:51026) |
| eptifibatide (CHEBI:291902) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| [(3R,11S,17S,20S,25aS)-11-(4-carbamimidamidobutyl)-3-carbamoyl-20-(1H-indol-3-ylmethyl)-1,9,12,15,18,21-hexaoxodocosahydro-7H-pyrrolo[2,1-g][1,2,5,8,11,14,17,20]dithiahexaazacyclotricosin-17-yl]acetic acid |
| Synonyms | Source |
|---|---|
| N6-amidino-N2-(3-mercaptopropionyl)-L-lysylglycyl-L-α-aspartyl-L-tryptophyl-L-prolyl-L-cysteinamide, cyclic(1-6)-disulfide | ChemIDplus |
| S1,S6-cyclo[N6-carbamimidoyl-N2-(3-sulfanylpropanoyl)-L-lysylglycyl-L-α-aspartyl-L-tryptophyl-L-prolyl-L-cysteinamide] | ChEBI |
| EPTIFIBATIDE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1040 | DrugCentral |
| D06888 | KEGG DRUG |
| DB00063 | DrugBank |
| Eptifibatide | Wikipedia |
| US5686570 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9608167 | Beilstein |
| CAS:188627-80-7 | KEGG COMPOUND |
| CAS:188627-80-7 | ChemIDplus |