EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N4O12P2 |
| Net Charge | 0 |
| Average Mass | 444.186 |
| Monoisotopic Mass | 444.00835 |
| SMILES | O=c1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H14N4O12P2/c15-5-3(1-24-28(22,23)26-27(19,20)21)25-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H,22,23)(H2,19,20,21)(H2,12,13,17,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | YMOPVQQBWLGDOD-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XDP (CHEBI:10048) has role Escherichia coli metabolite (CHEBI:76971) |
| XDP (CHEBI:10048) is a purine ribonucleoside 5'-diphosphate (CHEBI:37038) |
| XDP (CHEBI:10048) is a xanthosine 5'-phosphate (CHEBI:53012) |
| XDP (CHEBI:10048) is conjugate acid of XDP(3−) (CHEBI:59884) |
| Incoming Relation(s) |
| XDP(3−) (CHEBI:59884) is conjugate base of XDP (CHEBI:10048) |
| IUPAC Name |
|---|
| xanthosine 5'-(trihydrogen diphosphate) |
| Manual Xrefs | Databases |
|---|---|
| US4880918 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7400006 | Beilstein |