EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6 |
| Net Charge | -2 |
| Average Mass | 224.168 |
| Monoisotopic Mass | 224.03319 |
| SMILES | C=C(O[C@@H]1C=C(C(=O)[O-])C=C[C@H]1O)C(=O)[O-] |
| InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m1/s1 |
| InChIKey | WTFXTQVDAKGDEY-HTQZYQBOSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chorismate(2−) (CHEBI:29748) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| chorismate(2−) (CHEBI:29748) is a polyunsaturated dicarboxylic acid dianion (CHEBI:133492) |
| chorismate(2−) (CHEBI:29748) is conjugate base of chorismic acid (CHEBI:17333) |
| Incoming Relation(s) |
| 4-amino-4-deoxychorismate(2−) (CHEBI:35181) has functional parent chorismate(2−) (CHEBI:29748) |
| chorismic acid (CHEBI:17333) is conjugate acid of chorismate(2−) (CHEBI:29748) |
| IUPAC Name |
|---|
| (3R,4R)-3-[(1-carboxylatoethenyl)oxy]-4-hydroxycyclohexa-1,5-diene-1-carboxylate |
| UniProt Name | Source |
|---|---|
| chorismate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6278304 | Beilstein |