EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18+,21-/m0/s1 |
| InChIKey | SOSLMHZOJATCCP-AEIZVZFYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cornus macrophylla (ncbitaxon:60119) | leaf (BTO:0000713) | PubMed (24642906) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afzelin (CHEBI:80790) has functional parent kaempferol (CHEBI:28499) |
| afzelin (CHEBI:80790) has role anti-inflammatory agent (CHEBI:67079) |
| afzelin (CHEBI:80790) has role antibacterial agent (CHEBI:33282) |
| afzelin (CHEBI:80790) has role plant metabolite (CHEBI:76924) |
| afzelin (CHEBI:80790) is a glycosyloxyflavone (CHEBI:50018) |
| afzelin (CHEBI:80790) is a monosaccharide derivative (CHEBI:63367) |
| afzelin (CHEBI:80790) is a trihydroxyflavone (CHEBI:27116) |
| afzelin (CHEBI:80790) is conjugate acid of afzelin(1−) (CHEBI:144433) |
| Incoming Relation(s) |
| afzelin(1−) (CHEBI:144433) is conjugate base of afzelin (CHEBI:80790) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-ol | ChEBI |
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl α-L-rhamnoside | ChEBI |
| Kaempferin | KEGG COMPOUND |
| Kaempferol 3-O-α-L-rhamnopyranoside | ChEBI |
| kaempferol 3-O-α-L-rhamnoside | KEGG COMPOUND |
| kaempferol-3-rhamnoside | ChEBI |
| Citations |
|---|