EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | CCCCC/C=C/C=C1/C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H28O3/c1-2-3-4-5-6-9-12-17-15-16-19(21)18(17)13-10-7-8-11-14-20(22)23/h6-7,9-10,12,15-16,18H,2-5,8,11,13-14H2,1H3,(H,22,23)/b9-6+,10-7-,17-12-/t18-/m1/s1 |
| InChIKey | BHHHGDAJJMEHST-NBIYZLHXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-deoxy-Δ12,14-prostaglandin A2 (CHEBI:63975) has functional parent prostaglandin A2 (CHEBI:27820) |
| 15-deoxy-Δ12,14-prostaglandin A2 (CHEBI:63975) is a cyclic ketone (CHEBI:3992) |
| 15-deoxy-Δ12,14-prostaglandin A2 (CHEBI:63975) is a oxo monocarboxylic acid (CHEBI:35871) |
| 15-deoxy-Δ12,14-prostaglandin A2 (CHEBI:63975) is a prostaglandins A (CHEBI:26334) |
| IUPAC Name |
|---|
| (5Z,12Z,14E)-9-oxoprosta-5,10,12,14-tetraen-1-oic acid |
| Synonyms | Source |
|---|---|
| 15-deoxy-PGA2 | SUBMITTER |
| 15-deoxyprostaglandin A2 | ChEBI |
| 15-deoxy-δ-12,14-PGA2 | LIPID MAPS |
| 15d-PGA2 | SUBMITTER |
| 15d-prostaglandin A2 | ChEBI |
| 9-oxo-5Z,10,12Z,14E-prostatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010172 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2661205 | Reaxys |