EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | [H][C@]12CO[C@H](c3ccc(O)c(OC)c3)[C@@]1([H])CO[C@@H]2c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | HGXBRUKMWQGOIE-AFHBHXEDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-pinoresinol (CHEBI:40) has role hypoglycemic agent (CHEBI:35526) |
| (+)-pinoresinol (CHEBI:40) has role phytoestrogen (CHEBI:76989) |
| (+)-pinoresinol (CHEBI:40) has role plant metabolite (CHEBI:76924) |
| (+)-pinoresinol (CHEBI:40) is a pinoresinol (CHEBI:8225) |
| IUPAC Name |
|---|
| (7α,7'α,8α,8'α)-3,3'-dimethoxy-7,9':7',9-diepoxylignane-4,4'-diol |
| Synonyms | Source |
|---|---|
| 4,4'-(1S,3aR,4S,6aR)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(2-methoxyphenol) | IUPAC |
| pinoresinol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (+)-pinoresinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00007190 | KNApSAcK |
| C05366 | KEGG COMPOUND |
| CPD-8905 | MetaCyc |
| Pinoresinol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4238046 | Reaxys |
| CAS:487-36-5 | ChemIDplus |
| CAS:487-36-5 | KEGG COMPOUND |
| Citations |
|---|