EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CHCl3 |
| Net Charge | 0 |
| Average Mass | 119.378 |
| Monoisotopic Mass | 117.91438 |
| SMILES | [H]C(Cl)(Cl)Cl |
| InChI | InChI=1S/CHCl3/c2-1(3)4/h1H |
| InChIKey | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | refrigerant A substance used in a thermodynamic heat pump cycle or refrigeration cycle that undergoes a phase change from a gas to a liquid and back. Refrigerants are used in air-conditioning systems and freezers or refrigerators and are assigned a "R" number (by ASHRAE - formerly the American Society of Heating, Refrigerating and Air Conditioning Engineers), which is determined systematically according to their molecular structure. central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroform (CHEBI:35255) has role carcinogenic agent (CHEBI:50903) |
| chloroform (CHEBI:35255) has role central nervous system drug (CHEBI:35470) |
| chloroform (CHEBI:35255) has role inhalation anaesthetic (CHEBI:38870) |
| chloroform (CHEBI:35255) has role non-polar solvent (CHEBI:48355) |
| chloroform (CHEBI:35255) has role refrigerant (CHEBI:78433) |
| chloroform (CHEBI:35255) is a chloromethanes (CHEBI:23148) |
| chloroform (CHEBI:35255) is a one-carbon compound (CHEBI:64708) |
| Incoming Relation(s) |
| trichloromethyl group (CHEBI:30736) is substituent group from chloroform (CHEBI:35255) |
| IUPAC Name |
|---|
| chloroform |
| Synonyms | Source |
|---|---|
| 1,1,1-trichloromethane | ChemIDplus |
| CHCl3 | IUPAC |
| Chloroform | KEGG COMPOUND |
| chloroforme | ChemIDplus |
| chloroformium pro narcosi | ChEBI |
| Trichlormethan | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 4363 | DrugCentral |
| c0595 | UM-BBD |
| C13827 | KEGG COMPOUND |
| Chloroform | Wikipedia |
| CPD-843 | MetaCyc |
| HMDB0029596 | HMDB |
| LSM-37229 | LINCS |
| MCH | PDBeChem |
| Citations |
|---|