EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O5 |
| Net Charge | 0 |
| Average Mass | 276.288 |
| Monoisotopic Mass | 276.09977 |
| SMILES | C/C(=C/c1cc([C@@H]2CC=C(C(=O)O)CC2)co1)C(=O)O |
| InChI | InChI=1S/C15H16O5/c1-9(14(16)17)6-13-7-12(8-20-13)10-2-4-11(5-3-10)15(18)19/h4,6-8,10H,2-3,5H2,1H3,(H,16,17)(H,18,19)/b9-6-/t10-/m1/s1 |
| InChIKey | QOYLXSSNAZJJDH-ABRRARGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nidula candida (ncbitaxon:1348642) | - | PubMed (9031663) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Niduloic acid (CHEBI:199370) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 4-[5-[(Z)-2-carboxyprop-1-enyl]uran-3-yl]cyclohexene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8146251 | ChemSpider |