EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H34O |
| Net Charge | 0 |
| Average Mass | 242.447 |
| Monoisotopic Mass | 242.26097 |
| SMILES | CCCCCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C16H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17/h16-17H,3-15H2,1-2H3 |
| InChIKey | FVDRFBGMOWJEOR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | |
| Rhodococcus sp. Q15 (ncbitaxon:72804) | - | PubMed (9647833) | |
| Virgularia gustaviana (ncbitaxon:58815) | - | PubMed (32222494) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecan-2-ol (CHEBI:185029) has role animal metabolite (CHEBI:75767) |
| hexadecan-2-ol (CHEBI:185029) has role antibacterial agent (CHEBI:33282) |
| hexadecan-2-ol (CHEBI:185029) has role apoptosis inducer (CHEBI:68495) |
| hexadecan-2-ol (CHEBI:185029) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| hexadecan-2-ol (CHEBI:185029) has role marine metabolite (CHEBI:76507) |
| hexadecan-2-ol (CHEBI:185029) is a hexadecanol (CHEBI:197387) |
| hexadecan-2-ol (CHEBI:185029) is a secondary fatty alcohol (CHEBI:167095) |
| IUPAC Name |
|---|
| hexadecan-2-ol |
| Synonyms | Source |
|---|---|
| 2-hexadecanol | NIST Chemistry WebBook |
| 2-hydroxyhexadecane | ChEBI |
| hexadecanol-2 | NIST Chemistry WebBook |
| methyl tetradecyl carbinol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 77368 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1748421 | Reaxys |
| CAS:14852-31-4 | NIST Chemistry WebBook |
| Citations |
|---|