EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3 |
| InChIKey | ZBCATMYQYDCTIZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (22198556) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylcatechol (CHEBI:17254) has role antioxidant (CHEBI:22586) |
| 4-methylcatechol (CHEBI:17254) has role carcinogenic agent (CHEBI:50903) |
| 4-methylcatechol (CHEBI:17254) has role hapten (CHEBI:59174) |
| 4-methylcatechol (CHEBI:17254) has role human metabolite (CHEBI:77746) |
| 4-methylcatechol (CHEBI:17254) has role plant metabolite (CHEBI:76924) |
| 4-methylcatechol (CHEBI:17254) is a methylcatechol (CHEBI:25289) |
| Incoming Relation(s) |
| 3-chloro-4-methylcatechol (CHEBI:142284) has functional parent 4-methylcatechol (CHEBI:17254) |
| IUPAC Name |
|---|
| 4-methylbenzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 1,2-dihydroxy-4-methylbenzene | ChEBI |
| 1,2-Dihydroxy-4-methylbenzene | KEGG COMPOUND |
| 2-Hydroxy-4-methylphenol | NIST Chemistry WebBook |
| 3,4-dihydroxytoluene | ChEBI |
| 3,4-Dihydroxytoluene | KEGG COMPOUND |
| 4-methyl-1,2-benzenediol | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methylcatechol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4-Methylcatechol | Wikipedia |
| C00002660 | KNApSAcK |
| c0126 | UM-BBD |
| C06730 | KEGG COMPOUND |
| C06730 | KEGG COMPOUND |
| DB04120 | DrugBank |
| HMDB0000873 | HMDB |
| MCT | PDBeChem |
| Citations |
|---|