EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O |
| Net Charge | 0 |
| Average Mass | 126.199 |
| Monoisotopic Mass | 126.10447 |
| SMILES | CC(=O)CCC=C(C)C |
| InChI | InChI=1S/C8H14O/c1-7(2)5-4-6-8(3)9/h5H,4,6H2,1-3H3 |
| InChIKey | UHEPJGULSIKKTP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. alarm pheromone A pheromone which is released by an organism when damaged by a predator which warns other individuals that there is a danger. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcatone (CHEBI:16310) has role alarm pheromone (CHEBI:72575) |
| sulcatone (CHEBI:16310) has role plant metabolite (CHEBI:76924) |
| sulcatone (CHEBI:16310) has role volatile oil component (CHEBI:27311) |
| sulcatone (CHEBI:16310) is a heptenone (CHEBI:24523) |
| sulcatone (CHEBI:16310) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| 6-methylhept-5-en-2-one |
| Synonyms | Source |
|---|---|
| 6-methyl-5-hepten-2-one | ChEBI |
| 6-Methyl-5-hepten-2-one | KEGG COMPOUND |
| 6-methylhept-5-en-2-one | ChEBI |
| 6-Methylhept-5-en-2-one | KEGG COMPOUND |
| Sulcatone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| sulcatone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00011400 | KNApSAcK |
| C07287 | KEGG COMPOUND |
| HMDB0035915 | HMDB |
| Citations |
|---|