EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N4O2 |
| Net Charge | 0 |
| Average Mass | 256.265 |
| Monoisotopic Mass | 256.09603 |
| SMILES | CC(=O)ONc1nc2c3cccnc3ccc2n1C |
| InChI | InChI=1S/C13H12N4O2/c1-8(18)19-16-13-15-12-9-4-3-7-14-10(9)5-6-11(12)17(13)2/h3-7H,1-2H3,(H,15,16) |
| InChIKey | ZNLLBBZONQYLII-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (8069858) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (8069858) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(acetoxyamino)-3-methylimidazo[4,5-f]quinoline (CHEBI:133918) has role carcinogenic agent (CHEBI:50903) |
| 2-(acetoxyamino)-3-methylimidazo[4,5-f]quinoline (CHEBI:133918) has role human xenobiotic metabolite (CHEBI:76967) |
| 2-(acetoxyamino)-3-methylimidazo[4,5-f]quinoline (CHEBI:133918) has role rat metabolite (CHEBI:86264) |
| 2-(acetoxyamino)-3-methylimidazo[4,5-f]quinoline (CHEBI:133918) is a N-acetoxyarylamine (CHEBI:21494) |
| 2-(acetoxyamino)-3-methylimidazo[4,5-f]quinoline (CHEBI:133918) is a imidazoquinoline (CHEBI:38776) |
| IUPAC Name |
|---|
| 1-{[(Z)-(3-methyl-1,3-dihydro-2H-imidazo[4,5-f]quinolin-2-ylidene)amino]oxy}ethanone |
| Synonym | Source |
|---|---|
| N-Acetoxy-IQ | KEGG COMPOUND |
| Citations |
|---|