EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | CCOC(N)=O |
| InChI | InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5) |
| InChIKey | JOYRKODLDBILNP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| urethane (CHEBI:17967) has role fungal metabolite (CHEBI:76946) |
| urethane (CHEBI:17967) has role mutagen (CHEBI:25435) |
| urethane (CHEBI:17967) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| ethyl carbamate |
| Synonyms | Source |
|---|---|
| carbamic acid ethyl ester | ChEBI |
| Ethyl carbamate | KEGG COMPOUND |
| Urethane | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| urethane | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01537 | KEGG COMPOUND |
| DB04827 | DrugBank |
| Ethyl_carbamate | Wikipedia |
| HMDB0031219 | HMDB |
| LSM-37020 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:635810 | Reaxys |
| CAS:51-79-6 | KEGG COMPOUND |
| Citations |
|---|