EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H90O4 |
| Net Charge | 0 |
| Average Mass | 863.365 |
| Monoisotopic Mass | 862.68391 |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C59H90O4/c1-44(2)24-15-25-45(3)26-16-27-46(4)28-17-29-47(5)30-18-31-48(6)32-19-33-49(7)34-20-35-50(8)36-21-37-51(9)38-22-39-52(10)40-23-41-53(11)42-43-55-54(12)56(60)58(62-13)59(63-14)57(55)61/h24,26,28,30,32,34,36,38,40,42H,15-23,25,27,29,31,33,35,37,39,41,43H2,1-14H3/b45-26+,46-28+,47-30+,48-32+,49-34+,50-36+,51-38+,52-40+,53-42+ |
| InChIKey | ACTIUHUUMQJHFO-UPTCCGCDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme Q10 (CHEBI:46245) has role antioxidant (CHEBI:22586) |
| coenzyme Q10 (CHEBI:46245) has role ferroptosis inhibitor (CHEBI:173084) |
| coenzyme Q10 (CHEBI:46245) has role human metabolite (CHEBI:77746) |
| coenzyme Q10 (CHEBI:46245) is a ubiquinones (CHEBI:16389) |
| IUPAC Name |
|---|
| 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-5,6-dimethoxy-3-methyl-1,4-benzoquinone | ChEBI |
| 2-((all-E)-3,7,11,15,19,23,27,31,35,39-decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaenyl)-5,6-dimethoxy-3-methyl-p-benzoquinone | ChemIDplus |
| Adelir | KEGG DRUG |
| Coenzyme Q10 | KEGG COMPOUND |
| coenzyme Q10 | ChemIDplus |
| CoQ | ChEBI |
| UniProt Name | Source |
|---|---|
| ubiquinone-10 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4445197 | ChemSpider |
| 4607 | DrugCentral |
| C00002866 | KNApSAcK |
| C11378 | KEGG COMPOUND |
| Coenzyme_Q10 | Wikipedia |
| D01065 | KEGG DRUG |
| FDB013228 | FooDB |
| HMDB0001072 | HMDB |
| LMPR02010001 | LIPID MAPS |
| U10 | PDBeChem |
| UBIQUINONE-10 | MetaCyc |
| Citations |
|---|