EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H90O4 |
| Net Charge | 0 |
| Average Mass | 863.365 |
| Monoisotopic Mass | 862.68391 |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C59H90O4/c1-44(2)24-15-25-45(3)26-16-27-46(4)28-17-29-47(5)30-18-31-48(6)32-19-33-49(7)34-20-35-50(8)36-21-37-51(9)38-22-39-52(10)40-23-41-53(11)42-43-55-54(12)56(60)58(62-13)59(63-14)57(55)61/h24,26,28,30,32,34,36,38,40,42H,15-23,25,27,29,31,33,35,37,39,41,43H2,1-14H3/b45-26+,46-28+,47-30+,48-32+,49-34+,50-36+,51-38+,52-40+,53-42+ |
| InChIKey | ACTIUHUUMQJHFO-UPTCCGCDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. vulnerary A drug used in treating and healing of wounds. antiparkinson drug A drug used in the treatment of Parkinson's disease. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme Q10 (CHEBI:46245) has role antidepressant (CHEBI:35469) |
| coenzyme Q10 (CHEBI:46245) has role antineoplastic agent (CHEBI:35610) |
| coenzyme Q10 (CHEBI:46245) has role antioxidant (CHEBI:22586) |
| coenzyme Q10 (CHEBI:46245) has role antiparkinson drug (CHEBI:48407) |
| coenzyme Q10 (CHEBI:46245) has role antipsychotic agent (CHEBI:35476) |
| coenzyme Q10 (CHEBI:46245) has role cardiovascular drug (CHEBI:35554) |
| coenzyme Q10 (CHEBI:46245) has role ferroptosis inhibitor (CHEBI:173084) |
| coenzyme Q10 (CHEBI:46245) has role human metabolite (CHEBI:77746) |
| coenzyme Q10 (CHEBI:46245) has role hypoglycemic agent (CHEBI:35526) |
| coenzyme Q10 (CHEBI:46245) has role vulnerary (CHEBI:73336) |
| coenzyme Q10 (CHEBI:46245) is a ubiquinones (CHEBI:16389) |
| IUPAC Name |
|---|
| 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| INN | Source |
|---|---|
| ubidecarenona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-5,6-dimethoxy-3-methyl-1,4-benzoquinone | ChEBI |
| 2-((all-E)-3,7,11,15,19,23,27,31,35,39-decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaenyl)-5,6-dimethoxy-3-methyl-p-benzoquinone | ChemIDplus |
| Adelir | KEGG DRUG |
| API 31510 | ChEMBL |
| API-31510 | ChEMBL |
| Bpm-31510 | ChEMBL |
| UniProt Name | Source |
|---|---|
| ubiquinone-10 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4445197 | ChemSpider |
| 4607 | DrugCentral |
| C00002866 | KNApSAcK |
| C11378 | KEGG COMPOUND |
| Coenzyme_Q10 | Wikipedia |
| D01065 | KEGG DRUG |
| FDB013228 | FooDB |
| HMDB0001072 | HMDB |
| LMPR02010001 | LIPID MAPS |
| U10 | PDBeChem |
| UBIQUINONE-10 | MetaCyc |
| Citations |
|---|