EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO4 |
| Net Charge | 0 |
| Average Mass | 355.434 |
| Monoisotopic Mass | 355.17836 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(OC)c3CN1CCc1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m0/s1 |
| InChIKey | AEQDJSLRWYMAQI-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydropalmatine (CHEBI:16563) has functional parent palmatine (CHEBI:16096) |
| tetrahydropalmatine (CHEBI:16563) has role adrenergic agent (CHEBI:37962) |
| tetrahydropalmatine (CHEBI:16563) has role dopaminergic antagonist (CHEBI:48561) |
| tetrahydropalmatine (CHEBI:16563) has role non-narcotic analgesic (CHEBI:35481) |
| tetrahydropalmatine (CHEBI:16563) is a an (S)-7,8,13,14-tetrahydroprotoberberine (CHEBI:194528) |
| tetrahydropalmatine (CHEBI:16563) is a berberine alkaloid (CHEBI:22754) |
| tetrahydropalmatine (CHEBI:16563) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (13aS)-2,3,9,10-tetramethoxy-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinoline |
| Synonyms | Source |
|---|---|
| 2,3,9,10-tetramethoxy-13aα-berbine | ChemIDplus |
| (S)-(−)-tetrahydropalmatine | ChEBI |
| (S)-tetrahydropalmatine | ChemIDplus |
| L-tetrahydropalmatine | ChEBI |
| (S)-Tetrahydropalmatine | KEGG COMPOUND |
| (−)-tetrahydropalmatine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (S)-tetrahydropalmatine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00025252 | KNApSAcK |
| C02890 | KEGG COMPOUND |
| Tetrahydropalmatine | Wikipedia |
| TETRAHYDROPALMATINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96288 | Reaxys |
| CAS:483-14-7 | KEGG COMPOUND |
| CAS:483-14-7 | ChemIDplus |
| Citations |
|---|