EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O7 |
| Net Charge | 0 |
| Average Mass | 376.405 |
| Monoisotopic Mass | 376.15220 |
| SMILES | COc1cc(C(O)C(CO)Oc2ccc(/C=C/CO)cc2OC)ccc1O |
| InChI | InChI=1S/C20H24O7/c1-25-17-11-14(6-7-15(17)23)20(24)19(12-22)27-16-8-5-13(4-3-9-21)10-18(16)26-2/h3-8,10-11,19-24H,9,12H2,1-2H3/b4-3+ |
| InChIKey | FYEZJIXULOZDRT-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | MetaboLights (MTBLS160) | ||
| root (BTO:0001188) | PubMed (25457500) | ||
| Burkholderia cepacia (ncbitaxon:292) | - | PubMed (3839140) | |
| Pinus radiata (ncbitaxon:3347) | - | PubMed (23131896) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) has functional parent coniferol (CHEBI:17745) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) has functional parent guaiacylglycerol (CHEBI:53663) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) has role bacterial metabolite (CHEBI:76969) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) has role plant metabolite (CHEBI:76924) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) is a guaiacyl lignin (CHEBI:64475) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) is a monomethoxybenzene (CHEBI:25235) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) is a phenols (CHEBI:33853) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) is a primary alcohol (CHEBI:15734) |
| guaiacylglycerol β-coniferyl ether (CHEBI:91172) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-2-{4-[(1E)-3-hydroxy-1-propen-1-yl]-2-methoxyphenoxy}-1,3-propanediol |
| Synonyms | Source |
|---|---|
| G(8-O-4)G | ChEBI |
| GGBCE | ChemIDplus |
| Guaiacylglycerol-beta-coniferyl ether | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6537895 | Reaxys |
| CAS:1103-58-8 | ChemIDplus |
| Citations |
|---|