EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H47NO7 |
| Net Charge | 0 |
| Average Mass | 461.640 |
| Monoisotopic Mass | 461.33525 |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H47NO7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(27)18(25)17-31-24-23(30)22(29)21(28)20(16-26)32-24/h14-15,18-24,26-30H,2-13,16-17,25H2,1H3/b15-14+/t18-,19+,20+,21-,22-,23+,24+/m0/s1 |
| InChIKey | HHJTWTPUPVQKNA-PIIMIWFASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psychosine (CHEBI:16874) has functional parent sphing-4-enine (CHEBI:26743) |
| psychosine (CHEBI:16874) has functional parent sphingosine (CHEBI:16393) |
| psychosine (CHEBI:16874) has role human metabolite (CHEBI:77746) |
| psychosine (CHEBI:16874) is a glycosylsphingoid (CHEBI:36527) |
| psychosine (CHEBI:16874) is conjugate base of psychosine(1+) (CHEBI:57934) |
| Incoming Relation(s) |
| psychosine sulfate (CHEBI:17507) has functional parent psychosine (CHEBI:16874) |
| psychosine(1+) (CHEBI:57934) is conjugate acid of psychosine (CHEBI:16874) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-amino-3-hydroxyoctadec-4-en-1-yl β-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| 1-O-β-D-galactopyranosylsphingosine | ChEBI |
| 1-O-β-D-galactosylsphingosine | ChEBI |
| 1-β-D-galactosphingosine | ChEBI |
| 1-β-D-galactosylsphingosine | ChEBI |
| (2S,3R,4E)-2-amino-1-(β-D-galactopyranosyloxy)-3-hydroxyoctadec-4-ene | ChEBI |
| Galactosylsphingosine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01747 | KEGG COMPOUND |
| C01747 | KEGG COMPOUND |
| HMDB0000648 | HMDB |
| LMSP07000001 | LIPID MAPS |
| Psychosine | Wikipedia |
| PSYCHOSINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:52571 | Reaxys |
| CAS:2238-90-6 | KEGG COMPOUND |
| CAS:2238-90-6 | ChemIDplus |
| Citations |
|---|