EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O |
| Net Charge | 0 |
| Average Mass | 60.096 |
| Monoisotopic Mass | 60.05751 |
| SMILES | CC(C)O |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3 |
| InChIKey | KFZMGEQAYNKOFK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antipsoriatic A drug used to treat psoriasis. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. anti-inflammatory agent Any compound that has anti-inflammatory effects. antirheumatic drug A drug used to treat rheumatoid arthritis. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propan-2-ol (CHEBI:17824) has role anti-anaemic agent (CHEBI:75835) |
| propan-2-ol (CHEBI:17824) has role anti-inflammatory agent (CHEBI:67079) |
| propan-2-ol (CHEBI:17824) has role antiemetic (CHEBI:50919) |
| propan-2-ol (CHEBI:17824) has role antiinfective agent (CHEBI:35441) |
| propan-2-ol (CHEBI:17824) has role antineoplastic agent (CHEBI:35610) |
| propan-2-ol (CHEBI:17824) has role antipsoriatic (CHEBI:50748) |
| propan-2-ol (CHEBI:17824) has role antirheumatic drug (CHEBI:35842) |
| propan-2-ol (CHEBI:17824) has role dermatologic drug (CHEBI:50177) |
| propan-2-ol (CHEBI:17824) has role protic solvent (CHEBI:48356) |
| propan-2-ol (CHEBI:17824) is a secondary alcohol (CHEBI:35681) |
| propan-2-ol (CHEBI:17824) is a secondary fatty alcohol (CHEBI:167095) |
| Incoming Relation(s) |
| (S)-1-(2,5-xylyloxy)-3-morpholinopropan-2-ol (CHEBI:41617) has functional parent propan-2-ol (CHEBI:17824) |
| O-propan-2-yl hexanethioate (CHEBI:177491) has functional parent propan-2-ol (CHEBI:17824) |
| 1,1,1,3,3,3-hexafluoropropan-2-ol (CHEBI:63104) has functional parent propan-2-ol (CHEBI:17824) |
| isopropyl 3-hydroxybut-2-enoate (CHEBI:38868) has functional parent propan-2-ol (CHEBI:17824) |
| isopropyl ester (CHEBI:35725) has functional parent propan-2-ol (CHEBI:17824) |
| monoisopropyl phthalate (CHEBI:132587) has functional parent propan-2-ol (CHEBI:17824) |
| trimethyl(1-methylethoxy)silane (CHEBI:76336) has functional parent propan-2-ol (CHEBI:17824) |
| IUPAC Name |
|---|
| propan-2-ol |
| Synonyms | Source |
|---|---|
| 1-methylethanol | ChemIDplus |
| 1-methylethyl alcohol | ChemIDplus |
| 2-hydroxypropane | ChemIDplus |
| 2-Propanol | KEGG COMPOUND |
| 2-propanolum | ChEMBL |
| Alcohol,isopropyl | ChEMBL |
| Brand Names | Source |
|---|---|
| Isopropyl alcohol component of chloraprep | ChEMBL |
| Isopropyl alcohol component of duraprep | ChEMBL |
| Isopropyl alcohol component of soluprep | ChEMBL |
| Manugel | ChEMBL |
| Medi-swab | ChEMBL |
| Medi-swab h | ChEMBL |
| UniProt Name | Source |
|---|---|
| propan-2-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4215 | DrugCentral |
| C00048438 | KNApSAcK |
| C01845 | KEGG COMPOUND |
| c0519 | UM-BBD |
| D00137 | KEGG DRUG |
| DB04402 | DrugBank |
| HMDB0000863 | HMDB |
| IPA | PDBeChem |
| ISO-PROPANOL | MetaCyc |
| Isopropyl_Alcohol | Wikipedia |
| YMDB01718 | YMDB |
| Citations |
|---|