EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H62 |
| Net Charge | 0 |
| Average Mass | 542.936 |
| Monoisotopic Mass | 542.48515 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C=C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C40H62/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15,19-22,25,27-30H,13-14,16-18,23-24,26,31-32H2,1-10H3/b12-11+,25-15+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
| InChIKey | OVSVTCFNLSGAMM-OUOOUFEBSA-N |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-phytofluene (CHEBI:28129) has role human xenobiotic metabolite (CHEBI:76967) |
| all-trans-phytofluene (CHEBI:28129) has role plant metabolite (CHEBI:76924) |
| all-trans-phytofluene (CHEBI:28129) is a phytofluene (CHEBI:26120) |
| IUPAC Name |
|---|
| 7,8,11,12,7',8'-hexahydro-ψ,ψ-carotene |
| Synonyms | Source |
|---|---|
| Phytofluene | KEGG COMPOUND |
| 7,7',8,8',11,12-hexahydro-ψ,ψ-carotene | ChemIDplus |
| (12E,16E,18E,22E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,12,14,16,18,22,26,30-decaene | IUPAC |
| UniProt Name | Source |
|---|---|
| all-trans-phytofluene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05414 | KEGG COMPOUND |
| CPD-7408 | MetaCyc |
| HMDB0002272 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1730155 | Reaxys |
| CAS:540-05-6 | ChemIDplus |
| Citations |
|---|