EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O2 |
| Net Charge | 0 |
| Average Mass | 264.284 |
| Monoisotopic Mass | 264.08988 |
| SMILES | OCc1ccc(-c2nccc3c2nc2ccccc23)o1 |
| InChI | InChI=1S/C16H12N2O2/c19-9-10-5-6-14(20-10)16-15-12(7-8-17-16)11-3-1-2-4-13(11)18-15/h1-8,18-19H,9H2 |
| InChIKey | KFUCYPGCMLPUMT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perlolyrine (CHEBI:69444) has role metabolite (CHEBI:25212) |
| perlolyrine (CHEBI:69444) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Perlolyrine | KEGG COMPOUND |
| 2-Dehydrocarbonylflazin | ChEBI |
| 2-Furanmethanol, 5-(9H-pyrido(3,4-b)indol-1-yl)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09231 | KEGG COMPOUND |
| C00001756 | KNApSAcK |
| HMDB0030327 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:29700-20-7 | KEGG COMPOUND |
| CAS:29700-20-7 | ChemIDplus |
| Citations |
|---|