EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N2O4S |
| Net Charge | 0 |
| Average Mass | 278.374 |
| Monoisotopic Mass | 278.13003 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C11H22N2O4S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17)/t9-/m0/s1 |
| InChIKey | ZNXZGRMVNNHPCA-VIFPVBQESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantetheine (CHEBI:16753) has role human metabolite (CHEBI:77746) |
| pantetheine (CHEBI:16753) has role metabolite (CHEBI:25212) |
| pantetheine (CHEBI:16753) has role mouse metabolite (CHEBI:75771) |
| pantetheine (CHEBI:16753) is a pantetheines (CHEBI:25845) |
| pantetheine (CHEBI:16753) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| (2R)-2,4-dihydroxy-3,3-dimethyl-N-{3-oxo-3-[(2-sulfanylethyl)amino]propyl}butanamide |
| Synonyms | Source |
|---|---|
| Pantetheine | KEGG COMPOUND |
| D-Pantetheine | ChemIDplus |
| Lactobacillus bulgaricus factor | ChemIDplus |
| (R)-Pantetheine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (R)-pantetheine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00831 | KEGG COMPOUND |
| CPD-511 | MetaCyc |
| Pantetheine | Wikipedia |
| PNY | PDBeChem |
| FDB023172 | FooDB |
| HMDB0003426 | HMDB |
| 388453 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1714196 | Reaxys |
| CAS:496-65-1 | KEGG COMPOUND |
| CAS:496-65-1 | ChemIDplus |
| Citations |
|---|