EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22NO4 |
| Net Charge | +1 |
| Average Mass | 352.410 |
| Monoisotopic Mass | 352.15433 |
| SMILES | COc1cc2c(cc1OC)-c1cc3ccc(OC)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C21H22NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12H,7-8H2,1-4H3/q+1 |
| InChIKey | QUCQEUCGKKTEBI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coptis japonica (ncbitaxon:3442) | rhizome (BTO:0001181) | PubMed (21401114) | |
| Annona glabra (ncbitaxon:301703) | stem wood (BTO:0001469) | DOI (10.1021/np100247r) | Ethanolic extract of stemwood |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmatine (CHEBI:16096) has role plant metabolite (CHEBI:76924) |
| palmatine (CHEBI:16096) is a berberine alkaloid (CHEBI:22754) |
| palmatine (CHEBI:16096) is a organic heterotetracyclic compound (CHEBI:38163) |
| Incoming Relation(s) |
| tetrahydropalmatine (CHEBI:16563) has functional parent palmatine (CHEBI:16096) |
| IUPAC Name |
|---|
| 2,3,9,10-tetramethoxy-5,6-dihydroisoquino[3,2-a]isoquinolinium |
| Synonyms | Source |
|---|---|
| Palmatine | KEGG COMPOUND |
| 5,6-Dihydro-2,3,9,10-tetramethoxydibenzo[a,g]quinolizinium | KEGG COMPOUND |
| berbericinine | ChemIDplus |
| 7,8,13,13a-tetrahydro-2,3,9,10-tetramethoxyberbinium | ChemIDplus |
| O,O-dimethyldemethyleneberberine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| palmatine | UniProt |