EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@H](OC[C@H]2OC(O)(CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[ha122h-2x_2-5][a2122h-1a_1-5]/1-2/a6-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-4-6(15)8(17)9(18)11(22-4)21-2-5-7(16)10(19)12(20,3-14)23-5/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11+,12?/m1/s1 |
| InChIKey | PVXPPJIGRGXGCY-TZLCEDOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | - | PubMed (17548953) | |
| Saccharum officinarum (ncbitaxon:4547) | - | Article (ISBN:1118771389, Chapter 4) |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-α-D-glucopyranosyl-D-fructofuranose (CHEBI:18394) has role animal metabolite (CHEBI:75767) |
| 6-O-α-D-glucopyranosyl-D-fructofuranose (CHEBI:18394) has role plant metabolite (CHEBI:76924) |
| 6-O-α-D-glucopyranosyl-D-fructofuranose (CHEBI:18394) has role sweetening agent (CHEBI:50505) |
| 6-O-α-D-glucopyranosyl-D-fructofuranose (CHEBI:18394) is a glycosylfructose (CHEBI:35378) |
| Incoming Relation(s) |
| 6-O-α-D-glucopyranosyl-α-D-fructofuranose (CHEBI:47998) is a 6-O-α-D-glucopyranosyl-D-fructofuranose (CHEBI:18394) |
| 6-O-α-D-glucopyranosyl-β-D-fructofuranose (CHEBI:47999) is a 6-O-α-D-glucopyranosyl-D-fructofuranose (CHEBI:18394) |
| IUPAC Name |
|---|
| 6-O-α-D-glucopyranosyl-D-fructofuranose |
| Synonyms | Source |
|---|---|
| 6-O-alpha-D-Glucopyranosyl-D-fructofuranose | KEGG COMPOUND |
| isomaltulose | ChEBI |
| Palatinose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 6-O-α-D-glucopyranosyl-D-fructose | UniProt |
| Citations |
|---|