EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N7O19P3S |
| Net Charge | 0 |
| Average Mass | 839.560 |
| Monoisotopic Mass | 839.09995 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C(=O)O |
| InChI | InChI=1S/C23H36N7O19P3S/c1-23(2,16(33)19(34)26-4-3-12(31)25-5-6-53-22(37)21(35)36)8-46-52(43,44)49-51(41,42)45-7-11-15(48-50(38,39)40)14(32)20(47-11)30-10-29-13-17(24)27-9-28-18(13)30/h9-11,14-16,20,32-33H,3-8H2,1-2H3,(H,25,31)(H,26,34)(H,35,36)(H,41,42)(H,43,44)(H2,24,27,28)(H2,38,39,40)/t11-,14-,15-,16+,20-/m1/s1 |
| InChIKey | QVXMZFTWJVBUHP-IBOSZNHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxalyl-CoA (CHEBI:15535) has functional parent oxalic acid (CHEBI:16995) |
| oxalyl-CoA (CHEBI:15535) has role Escherichia coli metabolite (CHEBI:76971) |
| oxalyl-CoA (CHEBI:15535) is a ω-carboxyacyl-CoA (CHEBI:37555) |
| oxalyl-CoA (CHEBI:15535) is conjugate acid of oxalyl-CoA(5−) (CHEBI:57388) |
| Incoming Relation(s) |
| oxalyl-CoA(5−) (CHEBI:57388) is conjugate base of oxalyl-CoA (CHEBI:15535) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-(3-{(3R)-3-hydroxy-2,2-dimethyl-4-[(3-{[2-(oxalylsulfanyl)ethyl]amino}-3-oxopropyl)amino]-4-oxobutyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| Oxalyl-CoA | KEGG COMPOUND |
| OXALYL-COENZYME A | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00313 | KEGG COMPOUND |
| C00313 | KEGG COMPOUND |
| OXK | PDBeChem |
| HMDB0304445 | HMDB |
| FDB031077 | FooDB |
| LMFA07050357 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15648689 | Reaxys |
| Citations |
|---|